CAS 77207-49-9 appears in our catalog under these names: (Z)-2-(4-(1,2-Diphenylbut-1-en-1-yl)phenoxy)ethan-1-ol, 98%, 98%, Deamino-hydroxytamoxifen, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol (CAS 77207-49-9) is a chemical compound with the molecular formula C24H24O2 and a molecular weight of 344.4 g/mol. IUPAC name: 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol. InChIKey: TWASUFZMILCYJY-VHXPQNKSSA-N.
| Molecular formula | C24H24O2 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethanol |
| InChIKey | TWASUFZMILCYJY-VHXPQNKSSA-N |
| SMILES | CC/C(=C(\C1=CC=CC=C1)/C2=CC=C(C=C2)OCCO)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)