Products 1393444-79-5

CAS 1393444-79-5 is the registry number for 2-(3-Benzhydrylphenyl)-1,3-dioxolane, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 500mg, 1g, 2,5g, 5g.

Structural formula: {0} (CAS {1})

2-(3-benzhydrylphenyl)-1,3-dioxolane (CAS 1393444-79-5) is a chemical compound with the molecular formula C22H20O2 and a molecular weight of 316.4 g/mol. IUPAC name: 2-(3-benzhydrylphenyl)-1,3-dioxolane. InChIKey: UFRGXVLPNMHBBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H20O2
Molecular weight316.4 g/mol
IUPAC name2-(3-benzhydrylphenyl)-1,3-dioxolane
InChIKeyUFRGXVLPNMHBBZ-UHFFFAOYSA-N
SMILESC1COC(O1)C2=CC(=CC=C2)C(C3=CC=CC=C3)C4=CC=CC=C4

Computed by PubChem (NCBI)