CAS 89778-38-1 is the registry number for (E)-4-(4-Hydroxy-1,2-diphenylbut-1-en-1-yl)phenol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-[(E)-4-hydroxy-1,2-diphenylbut-1-enyl]phenol (CAS 89778-38-1) is a chemical compound with the molecular formula C22H20O2 and a molecular weight of 316.4 g/mol. IUPAC name: 4-[(E)-4-hydroxy-1,2-diphenylbut-1-enyl]phenol. InChIKey: JRAPAWFDOQVLLC-QURGRASLSA-N.
| Molecular formula | C22H20O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 4-[(E)-4-hydroxy-1,2-diphenylbut-1-enyl]phenol |
| InChIKey | JRAPAWFDOQVLLC-QURGRASLSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C(\C2=CC=CC=C2)/C3=CC=C(C=C3)O)/CCO |
Computed by PubChem (NCBI)