CAS 27720-54-3 is the registry number for 1,2-Dibenzoyl-4,5-dimethyl-1,4-cyclohexadiene, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 100mg.
(2-benzoyl-4,5-dimethylcyclohexa-1,4-dien-1-yl)-phenylmethanone (CAS 27720-54-3) is a chemical compound with the molecular formula C22H20O2 and a molecular weight of 316.4 g/mol. IUPAC name: (2-benzoyl-4,5-dimethylcyclohexa-1,4-dien-1-yl)-phenylmethanone. InChIKey: KDMUAKAUTZXNHO-UHFFFAOYSA-N.
| Molecular formula | C22H20O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (2-benzoyl-4,5-dimethylcyclohexa-1,4-dien-1-yl)-phenylmethanone |
| InChIKey | KDMUAKAUTZXNHO-UHFFFAOYSA-N |
| SMILES | CC1=C(CC(=C(C1)C(=O)C2=CC=CC=C2)C(=O)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)