Products 1393534-89-8
CAS 1393534-89-8 appears in our catalog under these names: 3-(Benzyloxy)-5-bromopyridine-2-carboxylic acid, 3-(Benzyloxy)-5-bromopicolinic acid, 97%, 5-Bromo-3-(phenylmethoxy)-2-pyridinecarboxylic acid, 97%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g, 100mg.
5-bromo-3-phenylmethoxypyridine-2-carboxylic acid (CAS 1393534-89-8) is a chemical compound with the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. IUPAC name: 5-bromo-3-phenylmethoxypyridine-2-carboxylic acid. InChIKey: RRBCYWSHMAGDMF-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO3 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 5-bromo-3-phenylmethoxypyridine-2-carboxylic acid |
| InChIKey | RRBCYWSHMAGDMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)