Products 1393540-50-5

CAS 1393540-50-5 is the registry number for Methyl 2,2-difluoro-2-(4-methylphenyl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2,2-difluoro-2-(4-methylphenyl)acetate (CAS 1393540-50-5) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: methyl 2,2-difluoro-2-(4-methylphenyl)acetate. InChIKey: LREJIQROZBQBFK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10F2O2
Molecular weight200.18 g/mol
IUPAC namemethyl 2,2-difluoro-2-(4-methylphenyl)acetate
InChIKeyLREJIQROZBQBFK-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C(C(=O)OC)(F)F

Computed by PubChem (NCBI)