CAS 773135-56-1 appears in our catalog under these names: 2,3-Difluoro-4-methylbenzoic acid ethyl ester, 95%, Ethyl 2,3-difluoro-4-methylbenzoate, 97%, Ethyl 2,3-difluoro-4-methylbenzoate, ≥95%, ≥95%, 2,3-Difluoro-4-methylbenzoic acid ethyl ester, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl 2,3-difluoro-4-methylbenzoate (CAS 773135-56-1) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: ethyl 2,3-difluoro-4-methylbenzoate. InChIKey: BTRWDPFKMBCWDA-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | ethyl 2,3-difluoro-4-methylbenzoate |
| InChIKey | BTRWDPFKMBCWDA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1)C)F)F |
Computed by PubChem (NCBI)