CAS 1781138-46-2 appears in our catalog under these names: 2,6-Difluoro-4-isopropyloxybenzaldehyde, 95%, 2,6-Difluoro-4-isopropyloxybenzaldehyde. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2,6-difluoro-4-propan-2-yloxybenzaldehyde (CAS 1781138-46-2) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: 2,6-difluoro-4-propan-2-yloxybenzaldehyde. InChIKey: KDYUJXMONZLDTE-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | 2,6-difluoro-4-propan-2-yloxybenzaldehyde |
| InChIKey | KDYUJXMONZLDTE-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C(=C1)F)C=O)F |
Computed by PubChem (NCBI)