Products 1393576-22-1
CAS 1393576-22-1 appears in our catalog under these names: 5-Bromo-2-chloro-4-methylnicotinic acid, 95%, 95%, 5-Bromo-2-chloro-4-methylnicotinic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
5-bromo-2-chloro-4-methylpyridine-3-carboxylic acid (CAS 1393576-22-1) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 5-bromo-2-chloro-4-methylpyridine-3-carboxylic acid. InChIKey: XQOXDWRAWWPLNW-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 5-bromo-2-chloro-4-methylpyridine-3-carboxylic acid |
| InChIKey | XQOXDWRAWWPLNW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1Br)Cl)C(=O)O |
Computed by PubChem (NCBI)