Products 1393576-39-0
CAS 1393576-39-0 appears in our catalog under these names: 6-Bromo-1,1-dimethyl-1,2,3,4-tetrahydroisoquinoline, 96%, 96%, 6-Bromo-1,1-dimethyl-1,2,3,4-tetrahydroisoquinoline, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-1,1-dimethyl-3,4-dihydro-2H-isoquinoline (CAS 1393576-39-0) is a chemical compound with the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. IUPAC name: 6-bromo-1,1-dimethyl-3,4-dihydro-2H-isoquinoline. InChIKey: WFFAZFOOYCMKDP-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | 6-bromo-1,1-dimethyl-3,4-dihydro-2H-isoquinoline |
| InChIKey | WFFAZFOOYCMKDP-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CCN1)C=C(C=C2)Br)C |
Computed by PubChem (NCBI)