Products 139399-67-0
CAS 139399-67-0 appears in our catalog under these names: 3-Bromoquinolin-8-amine, 97%, 3–Bromo–8–Quinolinamine, 3-bromoquinolin-8-amine, 3-Bromoquinolin-8-amine 95%, 3-Bromoquinolin-8-amine, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 50mg, 2g, 100mg.
3-bromoquinolin-8-amine (CAS 139399-67-0) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 3-bromoquinolin-8-amine. InChIKey: NDROWMOVSVLHDO-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 3-bromoquinolin-8-amine |
| InChIKey | NDROWMOVSVLHDO-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)N)Br |
Computed by PubChem (NCBI)