Products 13940-96-0
CAS 13940-96-0 appears in our catalog under these names: 3,4-Diamino diphenyl ether, 98%, 4–Phenoxybenzene–1，2–diamine, 4-Phenoxybenzene-1,2-diamine 98%, 4-Phenoxybenzene-1,2-diamine, 97%, 97%, 4-Phenoxybenzene-1,2-diamine, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
4-phenoxybenzene-1,2-diamine (CAS 13940-96-0) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: 4-phenoxybenzene-1,2-diamine. InChIKey: FJVIHKKXPLPDSV-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 4-phenoxybenzene-1,2-diamine |
| InChIKey | FJVIHKKXPLPDSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=C(C=C2)N)N |
Computed by PubChem (NCBI)