CAS 1394040-17-5 appears in our catalog under these names: (1-(4-Chlorophenyl)-2,2,2-trifluoroethyl)(methyl)amine hydrochloride, 95%, (1-(4-Chlorophenyl)-2,2,2-trifluoroethyl)(methyl)amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;hydrochloride (CAS 1394040-17-5) is a chemical compound with the molecular formula C9H10Cl2F3N and a molecular weight of 260.08 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;hydrochloride. InChIKey: HWHFKCSWXUUKOT-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2F3N |
|---|---|
| Molecular weight | 260.08 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;hydrochloride |
| InChIKey | HWHFKCSWXUUKOT-UHFFFAOYSA-N |
| SMILES | CNC(C1=CC=C(C=C1)Cl)C(F)(F)F.Cl |
Computed by PubChem (NCBI)