CAS 1803597-68-3 is the registry number for 2-(4-Chlorophenyl)-3,3,3-trifluoropropan-1-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(4-chlorophenyl)-3,3,3-trifluoropropan-1-amine;hydrochloride (CAS 1803597-68-3) is a chemical compound with the molecular formula C9H10Cl2F3N and a molecular weight of 260.08 g/mol. IUPAC name: 2-(4-chlorophenyl)-3,3,3-trifluoropropan-1-amine;hydrochloride. InChIKey: QUONQVNIAGOPNZ-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2F3N |
|---|---|
| Molecular weight | 260.08 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-3,3,3-trifluoropropan-1-amine;hydrochloride |
| InChIKey | QUONQVNIAGOPNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CN)C(F)(F)F)Cl.Cl |
Computed by PubChem (NCBI)