CAS 2203940-43-4 is the registry number for 1-(3-Chloro-4-trifluoromethyl-phenyl)-ethylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[3-chloro-4-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 2203940-43-4) is a chemical compound with the molecular formula C9H10Cl2F3N and a molecular weight of 260.08 g/mol. IUPAC name: 1-[3-chloro-4-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: MKLIPTAHHVPGMI-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2F3N |
|---|---|
| Molecular weight | 260.08 g/mol |
| IUPAC name | 1-[3-chloro-4-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | MKLIPTAHHVPGMI-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)C(F)(F)F)Cl)N.Cl |
Computed by PubChem (NCBI)