Products 1394040-92-6

CAS 1394040-92-6 is the registry number for 5H,6H,7H-(1,2,3)Triazolo(4,3-b)(1,3)thiazine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

6,7-dihydro-5H-triazolo[5,1-b][1,3]thiazine-6-carboxylic acid (CAS 1394040-92-6) is a chemical compound with the molecular formula C6H7N3O2S and a molecular weight of 185.21 g/mol. IUPAC name: 6,7-dihydro-5H-triazolo[5,1-b][1,3]thiazine-6-carboxylic acid. InChIKey: ZBHSDARDTZQJST-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7N3O2S
Molecular weight185.21 g/mol
IUPAC name6,7-dihydro-5H-triazolo[5,1-b][1,3]thiazine-6-carboxylic acid
InChIKeyZBHSDARDTZQJST-UHFFFAOYSA-N
SMILESC1C(CSC2=CN=NN21)C(=O)O

Computed by PubChem (NCBI)