CAS 2105948-93-2 is the registry number for 5-Methanesulfonyl-1-methyl-1H-pyrazole-4-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-methyl-5-methylsulfonylpyrazole-4-carbonitrile (CAS 2105948-93-2) is a chemical compound with the molecular formula C6H7N3O2S and a molecular weight of 185.21 g/mol. IUPAC name: 1-methyl-5-methylsulfonylpyrazole-4-carbonitrile. InChIKey: JNUPHRNWHXXKEE-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O2S |
|---|---|
| Molecular weight | 185.21 g/mol |
| IUPAC name | 1-methyl-5-methylsulfonylpyrazole-4-carbonitrile |
| InChIKey | JNUPHRNWHXXKEE-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C#N)S(=O)(=O)C |
Computed by PubChem (NCBI)