Products 605684-77-3

CAS 605684-77-3 is the registry number for 4-Amino-2-mercaptopyrimidine-5-carboxylic acid methyl ester. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.

Structural formula: {0} (CAS {1})

Methyl 6-amino-2-sulfanylidene-1H-pyrimidine-5-carboxylate (CAS 605684-77-3) is a chemical compound with the molecular formula C6H7N3O2S and a molecular weight of 185.21 g/mol. IUPAC name: methyl 6-amino-2-sulfanylidene-1H-pyrimidine-5-carboxylate. InChIKey: VXKCUARJYJLDMC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7N3O2S
Molecular weight185.21 g/mol
IUPAC namemethyl 6-amino-2-sulfanylidene-1H-pyrimidine-5-carboxylate
InChIKeyVXKCUARJYJLDMC-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(NC(=S)N=C1)N

Computed by PubChem (NCBI)