CAS 1394041-69-0 is the registry number for 6-amino-3-benzyl-3-azabicyclo(3.1.1)heptane-6-carboxylic acid dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
6-amino-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid;dihydrochloride (CAS 1394041-69-0) is a chemical compound with the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.2 g/mol. IUPAC name: 6-amino-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid;dihydrochloride. InChIKey: PJHMRVZETPAFGL-UHFFFAOYSA-N.
| Molecular formula | C14H20Cl2N2O2 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 6-amino-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid;dihydrochloride |
| InChIKey | PJHMRVZETPAFGL-UHFFFAOYSA-N |
| SMILES | C1C2CN(CC1C2(C(=O)O)N)CC3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)