CAS 157877-79-7 appears in our catalog under these names: Clencyclohexerol, Clencyclohexerol, >95% (HPLC), Clencyclohexerol, 95.31%, Clencyclohexerol (Standard). Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 1mg, 25mg, 5mg, 50mg, 100mg, 1 mg.
4-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]cyclohexan-1-ol (CAS 157877-79-7) is a chemical compound with the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.2 g/mol. IUPAC name: 4-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]cyclohexan-1-ol. InChIKey: DKFLKXDTRUWFDL-UHFFFAOYSA-N.
| Molecular formula | C14H20Cl2N2O2 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 4-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]cyclohexan-1-ol |
| InChIKey | DKFLKXDTRUWFDL-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1NCC(C2=CC(=C(C(=C2)Cl)N)Cl)O)O |
Computed by PubChem (NCBI)