CAS 51167-18-1 is the registry number for 1-Trimethylacetyl-2-(2,4-dichloro-5-isopropoxyphenyl)hydrazine. Offered by: TRC. Available pack sizes: 500mg.
N'-(2,4-dichloro-5-propan-2-yloxyphenyl)-2,2-dimethylpropanehydrazide (CAS 51167-18-1) is a chemical compound with the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.2 g/mol. IUPAC name: N'-(2,4-dichloro-5-propan-2-yloxyphenyl)-2,2-dimethylpropanehydrazide. InChIKey: IRVAUMHWBDVRPH-UHFFFAOYSA-N.
| Molecular formula | C14H20Cl2N2O2 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | N'-(2,4-dichloro-5-propan-2-yloxyphenyl)-2,2-dimethylpropanehydrazide |
| InChIKey | IRVAUMHWBDVRPH-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C(=C1)NNC(=O)C(C)(C)C)Cl)Cl |
Computed by PubChem (NCBI)