Products 1394041-86-1

CAS 1394041-86-1 appears in our catalog under these names: 2,5-Dibromo-4-methylbenzene-1-sulfonyl chloride, 2,5-Dibromo-4-methylbenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.

2,5-dibromo-4-methylbenzenesulfonyl chloride (CAS 1394041-86-1) is a chemical compound with the molecular formula C7H5Br2ClO2S and a molecular weight of 348.44 g/mol. IUPAC name: 2,5-dibromo-4-methylbenzenesulfonyl chloride. InChIKey: CPAWOFBDWQWEEC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Br2ClO2S
Molecular weight348.44 g/mol
IUPAC name2,5-dibromo-4-methylbenzenesulfonyl chloride
InChIKeyCPAWOFBDWQWEEC-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1Br)S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)