Products 73732-31-7

CAS 73732-31-7 appears in our catalog under these names: 2,6-Dibromo-4-methylbenzene-1-sulfonyl chloride, 95%, 2,6-Dibromo-4-methylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2,6-dibromo-4-methylbenzenesulfonyl chloride (CAS 73732-31-7) is a chemical compound with the molecular formula C7H5Br2ClO2S and a molecular weight of 348.44 g/mol. IUPAC name: 2,6-dibromo-4-methylbenzenesulfonyl chloride. InChIKey: FBGKSJGHOOGMGU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Br2ClO2S
Molecular weight348.44 g/mol
IUPAC name2,6-dibromo-4-methylbenzenesulfonyl chloride
InChIKeyFBGKSJGHOOGMGU-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)Br)S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)