CAS 1698325-95-9 is the registry number for (2,4-Dibromophenyl)methanesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2,4-dibromophenyl)methanesulfonyl chloride (CAS 1698325-95-9) is a chemical compound with the molecular formula C7H5Br2ClO2S and a molecular weight of 348.44 g/mol. IUPAC name: (2,4-dibromophenyl)methanesulfonyl chloride. InChIKey: NSEVYRJASHZPQQ-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2ClO2S |
|---|---|
| Molecular weight | 348.44 g/mol |
| IUPAC name | (2,4-dibromophenyl)methanesulfonyl chloride |
| InChIKey | NSEVYRJASHZPQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Br)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)