Products 139435-19-1
CAS 139435-19-1 is the registry number for rac-Jasmonic Acid-d6. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
2-[(1S,2S)-2-[(E)-3,4,4,5,5,5-hexadeuteriopent-2-enyl]-3-oxocyclopentyl]acetic acid (CAS 139435-19-1) is a chemical compound with the molecular formula C12H18O3 and a molecular weight of 216.31 g/mol. IUPAC name: 2-[(1S,2S)-2-[(E)-3,4,4,5,5,5-hexadeuteriopent-2-enyl]-3-oxocyclopentyl]acetic acid. InChIKey: ZNJFBWYDHIGLCU-QBYNJMDXSA-N.
| Molecular formula | C12H18O3 |
|---|---|
| Molecular weight | 216.31 g/mol |
| IUPAC name | 2-[(1S,2S)-2-[(E)-3,4,4,5,5,5-hexadeuteriopent-2-enyl]-3-oxocyclopentyl]acetic acid |
| InChIKey | ZNJFBWYDHIGLCU-QBYNJMDXSA-N |
| SMILES | [2H]/C(=C\C[C@H]1[C@@H](CCC1=O)CC(=O)O)/C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
rac-Jasmonic Acid-d6