Products 1821807-88-8
CAS 1821807-88-8 appears in our catalog under these names: Jasmonic Acid-d5, Jasmonic acid-d5, 98.0%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 5 mg, 1 mg.
2,2-dideuterio-2-[(2R)-2,4,4-trideuterio-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid (CAS 1821807-88-8) is a chemical compound with the molecular formula C12H18O3 and a molecular weight of 215.30 g/mol. IUPAC name: 2,2-dideuterio-2-[(2R)-2,4,4-trideuterio-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid. InChIKey: ZNJFBWYDHIGLCU-HVQZFGIGSA-N.
| Molecular formula | C12H18O3 |
|---|---|
| Molecular weight | 215.30 g/mol |
| IUPAC name | 2,2-dideuterio-2-[(2R)-2,4,4-trideuterio-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid |
| InChIKey | ZNJFBWYDHIGLCU-HVQZFGIGSA-N |
| SMILES | [2H][C@]1(C(CC(C1=O)([2H])[2H])C([2H])([2H])C(=O)O)C/C=C\CC |
Computed by PubChem (NCBI)