Products 903510-51-0
CAS 903510-51-0 is the registry number for rac-trans Jasmonic Acid-d3. Offered by: TRC. Available pack sizes: 25mg.
2-[(1S,2S)-3-oxo-2-[(Z)-5,5,5-trideuteriopent-2-enyl]cyclopentyl]acetic acid (CAS 903510-51-0) is a chemical compound with the molecular formula C12H18O3 and a molecular weight of 213.29 g/mol. IUPAC name: 2-[(1S,2S)-3-oxo-2-[(Z)-5,5,5-trideuteriopent-2-enyl]cyclopentyl]acetic acid. InChIKey: ZNJFBWYDHIGLCU-ONNWNUQWSA-N.
| Molecular formula | C12H18O3 |
|---|---|
| Molecular weight | 213.29 g/mol |
| IUPAC name | 2-[(1S,2S)-3-oxo-2-[(Z)-5,5,5-trideuteriopent-2-enyl]cyclopentyl]acetic acid |
| InChIKey | ZNJFBWYDHIGLCU-ONNWNUQWSA-N |
| SMILES | [2H]C([2H])([2H])C/C=C\C[C@H]1[C@@H](CCC1=O)CC(=O)O |
Computed by PubChem (NCBI)