CAS 139437-39-1 appears in our catalog under these names: 1,6-Anhydro-2-deoxy-2-iodo-β-D-glucopyranose, 1,6-Anhydro-2-iodo-2-deoxy-b-D-glucopyranose. Offered by: Biosynth, Chemat. Available pack sizes: 100mg, 50mg, 1g, 250mg, 2g, 500mg.
(1R,2S,3S,4R,5R)-4-iodo-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (CAS 139437-39-1) is a chemical compound with the molecular formula C6H9IO4 and a molecular weight of 272.04 g/mol. IUPAC name: (1R,2S,3S,4R,5R)-4-iodo-6,8-dioxabicyclo[3.2.1]octane-2,3-diol. InChIKey: SWUJNWULTXIUBD-QZABAPFNSA-N.
| Molecular formula | C6H9IO4 |
|---|---|
| Molecular weight | 272.04 g/mol |
| IUPAC name | (1R,2S,3S,4R,5R)-4-iodo-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| InChIKey | SWUJNWULTXIUBD-QZABAPFNSA-N |
| SMILES | C1[C@@H]2[C@H]([C@@H]([C@H]([C@H](O1)O2)I)O)O |
Computed by PubChem (NCBI)