Products 161254-78-0
CAS 161254-78-0 is the registry number for 1,4-Anhydro-2-deoxy-2-iodo-β-D-galactopyranose. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 25mg, 50mg.
(1S,3R,4R,5S,6R)-3-(hydroxymethyl)-6-iodo-2,7-dioxabicyclo[2.2.1]heptan-5-ol (CAS 161254-78-0) is a chemical compound with the molecular formula C6H9IO4 and a molecular weight of 272.04 g/mol. IUPAC name: (1S,3R,4R,5S,6R)-3-(hydroxymethyl)-6-iodo-2,7-dioxabicyclo[2.2.1]heptan-5-ol. InChIKey: ZPZNFONMLFOSRQ-TVIMKVIFSA-N.
| Molecular formula | C6H9IO4 |
|---|---|
| Molecular weight | 272.04 g/mol |
| IUPAC name | (1S,3R,4R,5S,6R)-3-(hydroxymethyl)-6-iodo-2,7-dioxabicyclo[2.2.1]heptan-5-ol |
| InChIKey | ZPZNFONMLFOSRQ-TVIMKVIFSA-N |
| SMILES | C([C@@H]1[C@H]2[C@@H]([C@H]([C@@H](O1)O2)I)O)O |
Computed by PubChem (NCBI)