CAS 161254-77-9 is the registry number for 1,6-Anhydro-2-deoxy-2-iodo-β-D-galactopyranose. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 50mg.
(1R,2R,3S,4R,5R)-4-iodo-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (CAS 161254-77-9) is a chemical compound with the molecular formula C6H9IO4 and a molecular weight of 272.04 g/mol. IUPAC name: (1R,2R,3S,4R,5R)-4-iodo-6,8-dioxabicyclo[3.2.1]octane-2,3-diol. InChIKey: SWUJNWULTXIUBD-VFUOTHLCSA-N.
| Molecular formula | C6H9IO4 |
|---|---|
| Molecular weight | 272.04 g/mol |
| IUPAC name | (1R,2R,3S,4R,5R)-4-iodo-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| InChIKey | SWUJNWULTXIUBD-VFUOTHLCSA-N |
| SMILES | C1[C@@H]2[C@@H]([C@@H]([C@H]([C@H](O1)O2)I)O)O |
Computed by PubChem (NCBI)