CAS 139452-53-2 appears in our catalog under these names: 6-Methyl-2-phenyl-3H,4H,5H,6H,7H,8H-pyrido(4,3-d)pyrimidin-4-one, 95%, 6-Methyl-2-phenyl-3H,4H,5H,6H,7H,8H-pyrido(4,3-d)pyrimidin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-methyl-2-phenyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (CAS 139452-53-2) is a chemical compound with the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. IUPAC name: 6-methyl-2-phenyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one. InChIKey: WGMOOYOVPLSQNC-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O |
|---|---|
| Molecular weight | 241.29 g/mol |
| IUPAC name | 6-methyl-2-phenyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| InChIKey | WGMOOYOVPLSQNC-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)C(=O)NC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)