CAS 1394827-82-7 is the registry number for (3R,4S)-1-Benzyl-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3R,4S)-1-benzyl-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid (CAS 1394827-82-7) is a chemical compound with the molecular formula C18H18FNO2 and a molecular weight of 299.3 g/mol. IUPAC name: (3R,4S)-1-benzyl-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid. InChIKey: PBJFFDZRBFEUPB-SJORKVTESA-N.
| Molecular formula | C18H18FNO2 |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | PBJFFDZRBFEUPB-SJORKVTESA-N |
| SMILES | C1[C@@H]([C@H](CN1CC2=CC=CC=C2)C(=O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)