CAS 874990-59-7 is the registry number for 1-Benzyl-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-benzyl-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid (CAS 874990-59-7) is a chemical compound with the molecular formula C18H18FNO2 and a molecular weight of 299.3 g/mol. IUPAC name: 1-benzyl-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid. InChIKey: PBJFFDZRBFEUPB-UHFFFAOYSA-N.
| Molecular formula | C18H18FNO2 |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | 1-benzyl-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | PBJFFDZRBFEUPB-UHFFFAOYSA-N |
| SMILES | C1C(C(CN1CC2=CC=CC=C2)C(=O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)