Products 1403483-75-9
CAS 1403483-75-9 is the registry number for Benzyl N-[1-(4-fluorophenyl)cyclobutyl]carbamate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Benzyl N-[1-(4-fluorophenyl)cyclobutyl]carbamate (CAS 1403483-75-9) is a chemical compound with the molecular formula C18H18FNO2 and a molecular weight of 299.3 g/mol. IUPAC name: benzyl N-[1-(4-fluorophenyl)cyclobutyl]carbamate. InChIKey: JTYTXASPXHGVMP-UHFFFAOYSA-N.
| Molecular formula | C18H18FNO2 |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | benzyl N-[1-(4-fluorophenyl)cyclobutyl]carbamate |
| InChIKey | JTYTXASPXHGVMP-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=C(C=C2)F)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)