CAS 139487-04-0 is the registry number for 5-Iodo-1,3-dimethyl-1,3-dihydro-2H-benzo[d]imidazol-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-iodo-1,3-dimethylbenzimidazol-2-one (CAS 139487-04-0) is a chemical compound with the molecular formula C9H9IN2O and a molecular weight of 288.08 g/mol. IUPAC name: 5-iodo-1,3-dimethylbenzimidazol-2-one. InChIKey: PHTYTHNNMCCFET-UHFFFAOYSA-N.
| Molecular formula | C9H9IN2O |
|---|---|
| Molecular weight | 288.08 g/mol |
| IUPAC name | 5-iodo-1,3-dimethylbenzimidazol-2-one |
| InChIKey | PHTYTHNNMCCFET-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)I)N(C1=O)C |
Computed by PubChem (NCBI)