Products 2857113-02-9
CAS 2857113-02-9 is the registry number for (3-Iodo-7-methyl-1H-indazol-6-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-iodo-7-methyl-2H-indazol-6-yl)methanol (CAS 2857113-02-9) is a chemical compound with the molecular formula C9H9IN2O and a molecular weight of 288.08 g/mol. IUPAC name: (3-iodo-7-methyl-2H-indazol-6-yl)methanol. InChIKey: VUSHMHGSTHNMJX-UHFFFAOYSA-N.
| Molecular formula | C9H9IN2O |
|---|---|
| Molecular weight | 288.08 g/mol |
| IUPAC name | (3-iodo-7-methyl-2H-indazol-6-yl)methanol |
| InChIKey | VUSHMHGSTHNMJX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C(NN=C12)I)CO |
Computed by PubChem (NCBI)