Products 328546-79-8
CAS 328546-79-8 appears in our catalog under these names: 9-Iodo-3,4-dihydro-1H-benzo(e)(1,4)diazepin-5(2H)-one, 97%, 9-Iodo-2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-5-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
9-iodo-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one (CAS 328546-79-8) is a chemical compound with the molecular formula C9H9IN2O and a molecular weight of 288.08 g/mol. IUPAC name: 9-iodo-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one. InChIKey: HCESKYHVILECLD-UHFFFAOYSA-N.
| Molecular formula | C9H9IN2O |
|---|---|
| Molecular weight | 288.08 g/mol |
| IUPAC name | 9-iodo-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
| InChIKey | HCESKYHVILECLD-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C(N1)C(=CC=C2)I |
Computed by PubChem (NCBI)