CAS 1394953-48-0 is the registry number for 2-Chloro-n,n-diethyl-4-hydroxybenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloro-N,N-diethyl-4-hydroxybenzamide (CAS 1394953-48-0) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 2-chloro-N,N-diethyl-4-hydroxybenzamide. InChIKey: BHQWOIIZBXXDKV-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 2-chloro-N,N-diethyl-4-hydroxybenzamide |
| InChIKey | BHQWOIIZBXXDKV-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=C(C=C1)O)Cl |
Computed by PubChem (NCBI)