Products 1394954-06-3
CAS 1394954-06-3 is the registry number for 2-chloro-5-fluoro-4-hydroxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-5-fluoro-4-hydroxybenzoic acid (CAS 1394954-06-3) is a chemical compound with the molecular formula C7H4ClFO3 and a molecular weight of 190.55 g/mol. IUPAC name: 2-chloro-5-fluoro-4-hydroxybenzoic acid. InChIKey: GGUVILIBYANXHC-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFO3 |
|---|---|
| Molecular weight | 190.55 g/mol |
| IUPAC name | 2-chloro-5-fluoro-4-hydroxybenzoic acid |
| InChIKey | GGUVILIBYANXHC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)O)Cl)C(=O)O |
Computed by PubChem (NCBI)