CAS 1784624-98-1 appears in our catalog under these names: 3-Chloro-6-fluoro-2-hydroxybenzoic acid, 95%, 3-Chloro-6-fluoro-2-hydroxybenzoic acid, 98%, 3-Chloro-6-fluoro-2-hydroxybenzoic acid, ≥95%, ≥95%, 3-Chloro-6-fluoro-2-hydroxybenzoic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
3-chloro-6-fluoro-2-hydroxybenzoic acid (CAS 1784624-98-1) is a chemical compound with the molecular formula C7H4ClFO3 and a molecular weight of 190.55 g/mol. IUPAC name: 3-chloro-6-fluoro-2-hydroxybenzoic acid. InChIKey: WBZAQRVNIFVIIN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFO3 |
|---|---|
| Molecular weight | 190.55 g/mol |
| IUPAC name | 3-chloro-6-fluoro-2-hydroxybenzoic acid |
| InChIKey | WBZAQRVNIFVIIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)O)Cl |
Computed by PubChem (NCBI)