Products 91659-15-3

CAS 91659-15-3 is the registry number for 2-Chloro-4-fluoro-5-hydroxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-chloro-4-fluoro-5-hydroxybenzoic acid (CAS 91659-15-3) is a chemical compound with the molecular formula C7H4ClFO3 and a molecular weight of 190.55 g/mol. IUPAC name: 2-chloro-4-fluoro-5-hydroxybenzoic acid. InChIKey: MAPYQXBFEPNRLV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClFO3
Molecular weight190.55 g/mol
IUPAC name2-chloro-4-fluoro-5-hydroxybenzoic acid
InChIKeyMAPYQXBFEPNRLV-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1O)F)Cl)C(=O)O

Computed by PubChem (NCBI)