CAS 139518-41-5 is the registry number for 3-(Benzoyloxy)propanoic Acid. Offered by: TRC. Available pack sizes: 250mg.
3-benzoyloxypropanoic acid (CAS 139518-41-5) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 3-benzoyloxypropanoic acid. InChIKey: ZFGVLYWWBSRAFN-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 3-benzoyloxypropanoic acid |
| InChIKey | ZFGVLYWWBSRAFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCCC(=O)O |
Computed by PubChem (NCBI)