CAS 1395282-61-7 is the registry number for 3-(3,5-Difluorophenyl)oxetane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3,5-difluorophenyl)oxetane (CAS 1395282-61-7) is a chemical compound with the molecular formula C9H8F2O and a molecular weight of 170.16 g/mol. IUPAC name: 3-(3,5-difluorophenyl)oxetane. InChIKey: HXPFONZQUZWQRU-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | 3-(3,5-difluorophenyl)oxetane |
| InChIKey | HXPFONZQUZWQRU-UHFFFAOYSA-N |
| SMILES | C1C(CO1)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)