CAS 261763-31-9 appears in our catalog under these names: 2',6'-Difluoro-3'-methylacetophenone, 95%, 1-(2,6-Difluoro-3-methylphenyl)ethanone 98+%, 1-(2,6-Difluoro-3-methylphenyl)ethanone, 98+%, 98+%, 2,6-Difluoro-3-methylacetophenone, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
1-(2,6-difluoro-3-methylphenyl)ethanone (CAS 261763-31-9) is a chemical compound with the molecular formula C9H8F2O and a molecular weight of 170.16 g/mol. IUPAC name: 1-(2,6-difluoro-3-methylphenyl)ethanone. InChIKey: BLSXKYBXBXVYJZ-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | 1-(2,6-difluoro-3-methylphenyl)ethanone |
| InChIKey | BLSXKYBXBXVYJZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C(=O)C)F |
Computed by PubChem (NCBI)