CAS 261763-30-8 appears in our catalog under these names: 2',3'-Difluoro-4'-methylacetophenone, 97%, 1-(2,3-Difluoro-4-methylphenyl)ethanone, 95+%, 2',3'-Difluoro-4'-methylacetophenone, 95%(NMR),RG, 95%(NMR),RG, 2,3-Difluoro-4-methylacetophenone. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 250mg.
1-(2,3-difluoro-4-methylphenyl)ethanone (CAS 261763-30-8) is a chemical compound with the molecular formula C9H8F2O and a molecular weight of 170.16 g/mol. IUPAC name: 1-(2,3-difluoro-4-methylphenyl)ethanone. InChIKey: PIYDLEQMYRPHPO-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | 1-(2,3-difluoro-4-methylphenyl)ethanone |
| InChIKey | PIYDLEQMYRPHPO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)C)F)F |
Computed by PubChem (NCBI)