CAS 139551-74-9 appears in our catalog under these names: Fmoc-t-butyl-L-alanine, >95% (HPLC), (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–4,4–dimethylpentanoic acid, Fmoc-L-NptGly-OH, Fmoc-neopentylglycine, Fmoc-β-tBu-Ala-OH 97%. Offered by: TRC, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 2g, 500g, 100mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-dimethylpentanoic acid (CAS 139551-74-9) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-dimethylpentanoic acid. InChIKey: RPLVCXKSSXJFDS-IBGZPJMESA-N.
| Molecular formula | C22H25NO4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-dimethylpentanoic acid |
| InChIKey | RPLVCXKSSXJFDS-IBGZPJMESA-N |
| SMILES | CC(C)(C)C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)