Products 139558-51-3
CAS 139558-51-3 is the registry number for Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-2,6-dimethyl-, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
3-(2,6-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 139558-51-3) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: 3-(2,6-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KJGYCJMJZYLARL-UHFFFAOYSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | 3-(2,6-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KJGYCJMJZYLARL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)CC(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)