Products 13956-43-9

CAS 13956-43-9 is the registry number for trans-3-Amino-2,2,4,4-tetramethylcyclobutanol hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-amino-2,2,4,4-tetramethylcyclobutan-1-ol;hydrochloride (CAS 13956-43-9) is a chemical compound with the molecular formula C8H18ClNO and a molecular weight of 179.69 g/mol. IUPAC name: 3-amino-2,2,4,4-tetramethylcyclobutan-1-ol;hydrochloride. InChIKey: YMBBKCTTZDWDRQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H18ClNO
Molecular weight179.69 g/mol
IUPAC name3-amino-2,2,4,4-tetramethylcyclobutan-1-ol;hydrochloride
InChIKeyYMBBKCTTZDWDRQ-UHFFFAOYSA-N
SMILESCC1(C(C(C1O)(C)C)N)C.Cl

Computed by PubChem (NCBI)