Products 1395886-42-6
CAS 1395886-42-6 appears in our catalog under these names: 2-((2-Chloropyrimidin-4-yl)amino)benzamide, 95%, 2–((2–Chloropyrimidin–4–yl)amino)benzamide. Offered by: AmBeed, GLPBio. Available pack sizes: 100mg.
2-[(2-chloropyrimidin-4-yl)amino]benzamide (CAS 1395886-42-6) is a chemical compound with the molecular formula C11H9ClN4O and a molecular weight of 248.67 g/mol. IUPAC name: 2-[(2-chloropyrimidin-4-yl)amino]benzamide. InChIKey: JJNWOWPIHQOTSK-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN4O |
|---|---|
| Molecular weight | 248.67 g/mol |
| IUPAC name | 2-[(2-chloropyrimidin-4-yl)amino]benzamide |
| InChIKey | JJNWOWPIHQOTSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)N)NC2=NC(=NC=C2)Cl |
Computed by PubChem (NCBI)