CAS 76947-79-0 is the registry number for SMARCA2/4-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(2-chloro-4-pyridinyl)-3-pyridin-2-ylurea (CAS 76947-79-0) is a chemical compound with the molecular formula C11H9ClN4O and a molecular weight of 248.67 g/mol. IUPAC name: 1-(2-chloro-4-pyridinyl)-3-pyridin-2-ylurea. InChIKey: VPYIBVZWTOMGGV-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN4O |
|---|---|
| Molecular weight | 248.67 g/mol |
| IUPAC name | 1-(2-chloro-4-pyridinyl)-3-pyridin-2-ylurea |
| InChIKey | VPYIBVZWTOMGGV-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NC(=O)NC2=CC(=NC=C2)Cl |
Computed by PubChem (NCBI)